About 6-(1H-indazol-6-yl)-2,2-dimethyl-3,4-dihydrochromen-4-ol
6-(1H-indazol-6-yl)-2,2-dimethyl-3,4-dihydrochromen-4-ol (PubChem CID 166240169) has the molecular formula C18H18N2O2
and a molecular weight of 294.35 g/mol. Its IUPAC name is 6-(1H-indazol-6-yl)-2,2-dimethyl-3,4-dihydrochromen-4-ol.
Molecular Properties
| Compound Name | 6-(1H-indazol-6-yl)-2,2-dimethyl-3,4-dihydrochromen-4-ol |
| PubChem CID | 166240169 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 6-(1H-indazol-6-yl)-2,2-dimethyl-3,4-dihydrochromen-4-ol |
| SMILES | CC1(C)CC(O)c2cc(-c3ccc4cn[nH]c4c3)ccc2O1 |
| InChI | InChI=1S/C18H18N2O2/c1-18(2)9-16(21)14-7-11(5-6-17(14)22-18)12-3-4-13-10-19-20-15(13)8-12/h3-8,10,16,21H,9H2,1-2H3,(H,19,20) |
| InChIKey | PBOIFFKWQNMGGQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 58.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(1H-indazol-6-yl)-2,2-dimethyl-3,4-dihydrochromen-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1H-indazol-6-yl)-2,2-dimethyl-3,4-dihydrochromen-4-ol?
The IUPAC name of 6-(1H-indazol-6-yl)-2,2-dimethyl-3,4-dihydrochromen-4-ol (CID 166240169) is 6-(1H-indazol-6-yl)-2,2-dimethyl-3,4-dihydrochromen-4-ol.
What is the SMILES notation for 6-(1H-indazol-6-yl)-2,2-dimethyl-3,4-dihydrochromen-4-ol?
The canonical SMILES for 6-(1H-indazol-6-yl)-2,2-dimethyl-3,4-dihydrochromen-4-ol is CC1(C)CC(O)c2cc(-c3ccc4cn[nH]c4c3)ccc2O1.
What is the InChIKey of 6-(1H-indazol-6-yl)-2,2-dimethyl-3,4-dihydrochromen-4-ol?
The InChIKey is PBOIFFKWQNMGGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O2/c1-18(2)9-16(21)14-7-11(5-6-17(14)22-18)12-3-4-13-10-19-20-15(13)8-12/h3-8,10,16,21H,9H2,1-2H3,(H,19,20).
What are the key properties of 6-(1H-indazol-6-yl)-2,2-dimethyl-3,4-dihydrochromen-4-ol?
6-(1H-indazol-6-yl)-2,2-dimethyl-3,4-dihydrochromen-4-ol has a molecular weight of 294.35 g/mol, XLogP of 3.82, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1H-indazol-6-yl)-2,2-dimethyl-3,4-dihydrochromen-4-ol is sourced from PubChem (CID 166240169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).