About (1S,4S)-5-[1-(2-fluorophenyl)pyrazol-4-yl]sulfonyl-2λ4-thia-5-azabicyclo[2.2.1]heptane 2-oxide
(1S,4S)-5-[1-(2-fluorophenyl)pyrazol-4-yl]sulfonyl-2λ4-thia-5-azabicyclo[2.2.1]heptane 2-oxide (PubChem CID 166240752) has the molecular formula C14H14FN3O3S2
and a molecular weight of 355.42 g/mol. Its IUPAC name is (1S,4S)-5-[1-(2-fluorophenyl)pyrazol-4-yl]sulfonyl-2λ4-thia-5-azabicyclo[2.2.1]heptane 2-oxide.
Molecular Properties
| Compound Name | (1S,4S)-5-[1-(2-fluorophenyl)pyrazol-4-yl]sulfonyl-2λ4-thia-5-azabicyclo[2.2.1]heptane 2-oxide |
| PubChem CID | 166240752 |
| Molecular Formula | C14H14FN3O3S2 |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | (1S,4S)-5-[1-(2-fluorophenyl)pyrazol-4-yl]sulfonyl-2λ4-thia-5-azabicyclo[2.2.1]heptane 2-oxide |
| SMILES | O=S1C[C@@H]2C[C@H]1CN2S(=O)(=O)c1cnn(-c2ccccc2F)c1 |
| InChI | InChI=1S/C14H14FN3O3S2/c15-13-3-1-2-4-14(13)17-8-12(6-16-17)23(20,21)18-7-11-5-10(18)9-22(11)19/h1-4,6,8,10-11H,5,7,9H2/t10-,11-,22?/m0/s1 |
| InChIKey | VMOIZVZLIYUHHE-QAIAGPJNSA-N |
| XLogP | 0.91 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1S,4S)-5-[1-(2-fluorophenyl)pyrazol-4-yl]sulfonyl-2λ4-thia-5-azabicyclo[2.2.1]heptane 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,4S)-5-[1-(2-fluorophenyl)pyrazol-4-yl]sulfonyl-2λ4-thia-5-azabicyclo[2.2.1]heptane 2-oxide?
The IUPAC name of (1S,4S)-5-[1-(2-fluorophenyl)pyrazol-4-yl]sulfonyl-2λ4-thia-5-azabicyclo[2.2.1]heptane 2-oxide (CID 166240752) is (1S,4S)-5-[1-(2-fluorophenyl)pyrazol-4-yl]sulfonyl-2λ4-thia-5-azabicyclo[2.2.1]heptane 2-oxide.
What is the SMILES notation for (1S,4S)-5-[1-(2-fluorophenyl)pyrazol-4-yl]sulfonyl-2λ4-thia-5-azabicyclo[2.2.1]heptane 2-oxide?
The canonical SMILES for (1S,4S)-5-[1-(2-fluorophenyl)pyrazol-4-yl]sulfonyl-2λ4-thia-5-azabicyclo[2.2.1]heptane 2-oxide is O=S1C[C@@H]2C[C@H]1CN2S(=O)(=O)c1cnn(-c2ccccc2F)c1.
What is the InChIKey of (1S,4S)-5-[1-(2-fluorophenyl)pyrazol-4-yl]sulfonyl-2λ4-thia-5-azabicyclo[2.2.1]heptane 2-oxide?
The InChIKey is VMOIZVZLIYUHHE-QAIAGPJNSA-N. The full InChI is InChI=1S/C14H14FN3O3S2/c15-13-3-1-2-4-14(13)17-8-12(6-16-17)23(20,21)18-7-11-5-10(18)9-22(11)19/h1-4,6,8,10-11H,5,7,9H2/t10-,11-,22?/m0/s1.
What are the key properties of (1S,4S)-5-[1-(2-fluorophenyl)pyrazol-4-yl]sulfonyl-2λ4-thia-5-azabicyclo[2.2.1]heptane 2-oxide?
(1S,4S)-5-[1-(2-fluorophenyl)pyrazol-4-yl]sulfonyl-2λ4-thia-5-azabicyclo[2.2.1]heptane 2-oxide has a molecular weight of 355.42 g/mol, XLogP of 0.91, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,4S)-5-[1-(2-fluorophenyl)pyrazol-4-yl]sulfonyl-2λ4-thia-5-azabicyclo[2.2.1]heptane 2-oxide is sourced from PubChem (CID 166240752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).