C18H19N7O2 — CID 166241253
N-[(2-morpholin-4-ylphenyl)methyl]-5-(tetrazol-1-yl)pyridine-2-carboxamide (PubChem CID 166241253) has the molecular formula C18H19N7O2 and a molecular weight of 365.40 g/mol. Its IUPAC name is N-[(2-morpholin-4-ylphenyl)methyl]-5-(tetrazol-1-yl)pyridine-2-carboxamide.
| Compound Name | N-[(2-morpholin-4-ylphenyl)methyl]-5-(tetrazol-1-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 166241253 |
| Molecular Formula | C18H19N7O2 |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | N-[(2-morpholin-4-ylphenyl)methyl]-5-(tetrazol-1-yl)pyridine-2-carboxamide |
| SMILES | O=C(NCc1ccccc1N1CCOCC1)c1ccc(-n2cnnn2)cn1 |
| InChI | InChI=1S/C18H19N7O2/c26-18(16-6-5-15(12-19-16)25-13-21-22-23-25)20-11-14-3-1-2-4-17(14)24-7-9-27-10-8-24/h1-6,12-13H,7-11H2,(H,20,26) |
| InChIKey | HUHJESCGFQMDCG-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |