C14H15F3N2O3 — CID 166241496
1-[[2-[4-(trifluoromethyl)-3-pyridinyl]acetyl]amino]cyclopentane-1-carboxylic acid (PubChem CID 166241496) has the molecular formula C14H15F3N2O3 and a molecular weight of 316.28 g/mol. Its IUPAC name is 1-[[2-[4-(trifluoromethyl)-3-pyridinyl]acetyl]amino]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[[2-[4-(trifluoromethyl)-3-pyridinyl]acetyl]amino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 166241496 |
| Molecular Formula | C14H15F3N2O3 |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 1-[[2-[4-(trifluoromethyl)-3-pyridinyl]acetyl]amino]cyclopentane-1-carboxylic acid |
| SMILES | O=C(Cc1cnccc1C(F)(F)F)NC1(C(=O)O)CCCC1 |
| InChI | InChI=1S/C14H15F3N2O3/c15-14(16,17)10-3-6-18-8-9(10)7-11(20)19-13(12(21)22)4-1-2-5-13/h3,6,8H,1-2,4-5,7H2,(H,19,20)(H,21,22) |
| InChIKey | DXDGSESXJYLACU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |