About N-(1,2-benzothiazol-3-ylmethyl)-4-methylthiolan-3-amine
N-(1,2-benzothiazol-3-ylmethyl)-4-methylthiolan-3-amine (PubChem CID 166242997) has the molecular formula C13H16N2S2
and a molecular weight of 264.42 g/mol. Its IUPAC name is N-(1,2-benzothiazol-3-ylmethyl)-4-methylthiolan-3-amine.
Molecular Properties
| Compound Name | N-(1,2-benzothiazol-3-ylmethyl)-4-methylthiolan-3-amine |
| PubChem CID | 166242997 |
| Molecular Formula | C13H16N2S2 |
| Molecular Weight | 264.42 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | N-(1,2-benzothiazol-3-ylmethyl)-4-methylthiolan-3-amine |
| SMILES | CC1CSCC1NCc1nsc2ccccc12 |
| InChI | InChI=1S/C13H16N2S2/c1-9-7-16-8-12(9)14-6-11-10-4-2-3-5-13(10)17-15-11/h2-5,9,12,14H,6-8H2,1H3 |
| InChIKey | ZTNFRFLVHLRSTR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1,2-benzothiazol-3-ylmethyl)-4-methylthiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,2-benzothiazol-3-ylmethyl)-4-methylthiolan-3-amine?
The IUPAC name of N-(1,2-benzothiazol-3-ylmethyl)-4-methylthiolan-3-amine (CID 166242997) is N-(1,2-benzothiazol-3-ylmethyl)-4-methylthiolan-3-amine.
What is the SMILES notation for N-(1,2-benzothiazol-3-ylmethyl)-4-methylthiolan-3-amine?
The canonical SMILES for N-(1,2-benzothiazol-3-ylmethyl)-4-methylthiolan-3-amine is CC1CSCC1NCc1nsc2ccccc12.
What is the InChIKey of N-(1,2-benzothiazol-3-ylmethyl)-4-methylthiolan-3-amine?
The InChIKey is ZTNFRFLVHLRSTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2S2/c1-9-7-16-8-12(9)14-6-11-10-4-2-3-5-13(10)17-15-11/h2-5,9,12,14H,6-8H2,1H3.
What are the key properties of N-(1,2-benzothiazol-3-ylmethyl)-4-methylthiolan-3-amine?
N-(1,2-benzothiazol-3-ylmethyl)-4-methylthiolan-3-amine has a molecular weight of 264.42 g/mol, XLogP of 3.14, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,2-benzothiazol-3-ylmethyl)-4-methylthiolan-3-amine is sourced from PubChem (CID 166242997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).