C20H21N3O4 — CID 166243419
3-(3,4-dimethoxyphenyl)-4-(1,2,3,4-tetrahydroisoquinolin-5-ylmethyl)-1,2,4-oxadiazol-5-one (PubChem CID 166243419) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-4-(1,2,3,4-tetrahydroisoquinolin-5-ylmethyl)-1,2,4-oxadiazol-5-one.
| Compound Name | 3-(3,4-dimethoxyphenyl)-4-(1,2,3,4-tetrahydroisoquinolin-5-ylmethyl)-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 166243419 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-4-(1,2,3,4-tetrahydroisoquinolin-5-ylmethyl)-1,2,4-oxadiazol-5-one |
| SMILES | COc1ccc(-c2noc(=O)n2Cc2cccc3c2CCNC3)cc1OC |
| InChI | InChI=1S/C20H21N3O4/c1-25-17-7-6-13(10-18(17)26-2)19-22-27-20(24)23(19)12-15-5-3-4-14-11-21-9-8-16(14)15/h3-7,10,21H,8-9,11-12H2,1-2H3 |
| InChIKey | VQDIXSYPDHFIPK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |