C15H16N6O2S — CID 166243481
3-(furan-2-yl)-4-[(E)-[(2R,3S)-2-(1-methylpyrazol-4-yl)oxolan-3-yl]methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 166243481) has the molecular formula C15H16N6O2S and a molecular weight of 344.40 g/mol. Its IUPAC name is 3-(furan-2-yl)-4-[(E)-[(2R,3S)-2-(1-methylpyrazol-4-yl)oxolan-3-yl]methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(furan-2-yl)-4-[(E)-[(2R,3S)-2-(1-methylpyrazol-4-yl)oxolan-3-yl]methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 166243481 |
| Molecular Formula | C15H16N6O2S |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 3-(furan-2-yl)-4-[(E)-[(2R,3S)-2-(1-methylpyrazol-4-yl)oxolan-3-yl]methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | Cn1cc([C@@H]2OCC[C@H]2/C=N/n2c(-c3ccco3)n[nH]c2=S)cn1 |
| InChI | InChI=1S/C15H16N6O2S/c1-20-9-11(8-16-20)13-10(4-6-23-13)7-17-21-14(18-19-15(21)24)12-3-2-5-22-12/h2-3,5,7-10,13H,4,6H2,1H3,(H,19,24)/b17-7+/t10-,13+/m0/s1 |
| InChIKey | CGLUJADKWVSTBY-VJUWEASZSA-N |
| XLogP | 2.55 |
| TPSA | 86.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|