C10H13F3N2O6 — CID 166244617
(5S)-N-cyclobutyloxy-2-oxo-1,3-oxazolidine-5-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 166244617) has the molecular formula C10H13F3N2O6 and a molecular weight of 314.22 g/mol. Its IUPAC name is (5S)-N-cyclobutyloxy-2-oxo-1,3-oxazolidine-5-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (5S)-N-cyclobutyloxy-2-oxo-1,3-oxazolidine-5-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166244617 |
| Molecular Formula | C10H13F3N2O6 |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | (5S)-N-cyclobutyloxy-2-oxo-1,3-oxazolidine-5-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C1NC[C@@H](C(=O)NOC2CCC2)O1 |
| InChI | InChI=1S/C8H12N2O4.C2HF3O2/c11-7(6-4-9-8(12)13-6)10-14-5-2-1-3-5;3-2(4,5)1(6)7/h5-6H,1-4H2,(H,9,12)(H,10,11);(H,6,7)/t6-;/m0./s1 |
| InChIKey | YCWUIIAFFGVPAT-RGMNGODLSA-N |
| XLogP | 0.33 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|