C18H16F2N4OS — CID 166244981
N-[5-[(2,6-difluorophenyl)methyl]-1,3-thiazol-2-yl]-4,5,6,7-tetrahydro-1H-benzimidazole-4-carboxamide (PubChem CID 166244981) has the molecular formula C18H16F2N4OS and a molecular weight of 374.42 g/mol. Its IUPAC name is N-[5-[(2,6-difluorophenyl)methyl]-1,3-thiazol-2-yl]-4,5,6,7-tetrahydro-1H-benzimidazole-4-carboxamide.
| Compound Name | N-[5-[(2,6-difluorophenyl)methyl]-1,3-thiazol-2-yl]-4,5,6,7-tetrahydro-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 166244981 |
| Molecular Formula | C18H16F2N4OS |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | N-[5-[(2,6-difluorophenyl)methyl]-1,3-thiazol-2-yl]-4,5,6,7-tetrahydro-1H-benzimidazole-4-carboxamide |
| SMILES | O=C(Nc1ncc(Cc2c(F)cccc2F)s1)C1CCCc2[nH]cnc21 |
| InChI | InChI=1S/C18H16F2N4OS/c19-13-4-2-5-14(20)12(13)7-10-8-21-18(26-10)24-17(25)11-3-1-6-15-16(11)23-9-22-15/h2,4-5,8-9,11H,1,3,6-7H2,(H,22,23)(H,21,24,25) |
| InChIKey | UKUZJPSSYDMVJH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |