C28H30N6O3 — CID 166245205
[(4R,6R)-4-ethoxy-2,8,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-trien-8-yl]-(3-propyl-6-pyridin-3-yl-[1,2]oxazolo[5,4-b]pyridin-4-yl)methanone (PubChem CID 166245205) has the molecular formula C28H30N6O3 and a molecular weight of 498.59 g/mol. Its IUPAC name is [(4R,6R)-4-ethoxy-2,8,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-trien-8-yl]-(3-propyl-6-pyridin-3-yl-[1,2]oxazolo[5,4-b]pyridin-4-yl)methanone.
| Compound Name | [(4R,6R)-4-ethoxy-2,8,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-trien-8-yl]-(3-propyl-6-pyridin-3-yl-[1,2]oxazolo[5,4-b]pyridin-4-yl)methanone |
|---|---|
| PubChem CID | 166245205 |
| Molecular Formula | C28H30N6O3 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | [(4R,6R)-4-ethoxy-2,8,14-triazatricyclo[8.4.0.02,6]tetradeca-1(10),11,13-trien-8-yl]-(3-propyl-6-pyridin-3-yl-[1,2]oxazolo[5,4-b]pyridin-4-yl)methanone |
| SMILES | CCCc1noc2nc(-c3cccnc3)cc(C(=O)N3Cc4cccnc4N4C[C@H](OCC)C[C@@H]4C3)c12 |
| InChI | InChI=1S/C28H30N6O3/c1-3-7-23-25-22(13-24(31-27(25)37-32-23)18-8-5-10-29-14-18)28(35)33-15-19-9-6-11-30-26(19)34-17-21(36-4-2)12-20(34)16-33/h5-6,8-11,13-14,20-21H,3-4,7,12,15-17H2,1-2H3/t20-,21-/m1/s1 |
| InChIKey | FDQKPIARRASBHC-NHCUHLMSSA-N |
| XLogP | 4.27 |
| TPSA | 97.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |