About N-(1-cyclohexyl-2,2-difluoroethyl)-2-thiomorpholin-4-ylpropanamide
N-(1-cyclohexyl-2,2-difluoroethyl)-2-thiomorpholin-4-ylpropanamide (PubChem CID 166245621) has the molecular formula C15H26F2N2OS
and a molecular weight of 320.45 g/mol. Its IUPAC name is N-(1-cyclohexyl-2,2-difluoroethyl)-2-thiomorpholin-4-ylpropanamide.
Molecular Properties
| Compound Name | N-(1-cyclohexyl-2,2-difluoroethyl)-2-thiomorpholin-4-ylpropanamide |
| PubChem CID | 166245621 |
| Molecular Formula | C15H26F2N2OS |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | N-(1-cyclohexyl-2,2-difluoroethyl)-2-thiomorpholin-4-ylpropanamide |
| SMILES | CC(C(=O)NC(C(F)F)C1CCCCC1)N1CCSCC1 |
| InChI | InChI=1S/C15H26F2N2OS/c1-11(19-7-9-21-10-8-19)15(20)18-13(14(16)17)12-5-3-2-4-6-12/h11-14H,2-10H2,1H3,(H,18,20) |
| InChIKey | ZIZFAXNYOKPLIC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1-cyclohexyl-2,2-difluoroethyl)-2-thiomorpholin-4-ylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-cyclohexyl-2,2-difluoroethyl)-2-thiomorpholin-4-ylpropanamide?
The IUPAC name of N-(1-cyclohexyl-2,2-difluoroethyl)-2-thiomorpholin-4-ylpropanamide (CID 166245621) is N-(1-cyclohexyl-2,2-difluoroethyl)-2-thiomorpholin-4-ylpropanamide.
What is the SMILES notation for N-(1-cyclohexyl-2,2-difluoroethyl)-2-thiomorpholin-4-ylpropanamide?
The canonical SMILES for N-(1-cyclohexyl-2,2-difluoroethyl)-2-thiomorpholin-4-ylpropanamide is CC(C(=O)NC(C(F)F)C1CCCCC1)N1CCSCC1.
What is the InChIKey of N-(1-cyclohexyl-2,2-difluoroethyl)-2-thiomorpholin-4-ylpropanamide?
The InChIKey is ZIZFAXNYOKPLIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26F2N2OS/c1-11(19-7-9-21-10-8-19)15(20)18-13(14(16)17)12-5-3-2-4-6-12/h11-14H,2-10H2,1H3,(H,18,20).
What are the key properties of N-(1-cyclohexyl-2,2-difluoroethyl)-2-thiomorpholin-4-ylpropanamide?
N-(1-cyclohexyl-2,2-difluoroethyl)-2-thiomorpholin-4-ylpropanamide has a molecular weight of 320.45 g/mol, XLogP of 2.75, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-cyclohexyl-2,2-difluoroethyl)-2-thiomorpholin-4-ylpropanamide is sourced from PubChem (CID 166245621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).