About 4-(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)-2-(ethoxymethyl)morpholine
4-(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)-2-(ethoxymethyl)morpholine (PubChem CID 166246196) has the molecular formula C18H24N4O2
and a molecular weight of 328.42 g/mol. Its IUPAC name is 4-(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)-2-(ethoxymethyl)morpholine.
Molecular Properties
| Compound Name | 4-(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)-2-(ethoxymethyl)morpholine |
| PubChem CID | 166246196 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 4-(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)-2-(ethoxymethyl)morpholine |
| SMILES | CCOCC1CN(c2nc(-c3ccccn3)nc(C)c2C)CCO1 |
| InChI | InChI=1S/C18H24N4O2/c1-4-23-12-15-11-22(9-10-24-15)18-13(2)14(3)20-17(21-18)16-7-5-6-8-19-16/h5-8,15H,4,9-12H2,1-3H3 |
| InChIKey | ZMVGYQZEYYUNMX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)-2-(ethoxymethyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)-2-(ethoxymethyl)morpholine?
The IUPAC name of 4-(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)-2-(ethoxymethyl)morpholine (CID 166246196) is 4-(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)-2-(ethoxymethyl)morpholine.
What is the SMILES notation for 4-(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)-2-(ethoxymethyl)morpholine?
The canonical SMILES for 4-(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)-2-(ethoxymethyl)morpholine is CCOCC1CN(c2nc(-c3ccccn3)nc(C)c2C)CCO1.
What is the InChIKey of 4-(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)-2-(ethoxymethyl)morpholine?
The InChIKey is ZMVGYQZEYYUNMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N4O2/c1-4-23-12-15-11-22(9-10-24-15)18-13(2)14(3)20-17(21-18)16-7-5-6-8-19-16/h5-8,15H,4,9-12H2,1-3H3.
What are the key properties of 4-(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)-2-(ethoxymethyl)morpholine?
4-(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)-2-(ethoxymethyl)morpholine has a molecular weight of 328.42 g/mol, XLogP of 2.40, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5,6-dimethyl-2-pyridin-2-ylpyrimidin-4-yl)-2-(ethoxymethyl)morpholine is sourced from PubChem (CID 166246196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).