About 3-cyclopropyl-N-[(4,5-dimethyl-1H-imidazol-2-yl)methyl]aniline
3-cyclopropyl-N-[(4,5-dimethyl-1H-imidazol-2-yl)methyl]aniline (PubChem CID 166246305) has the molecular formula C15H19N3
and a molecular weight of 241.34 g/mol. Its IUPAC name is 3-cyclopropyl-N-[(4,5-dimethyl-1H-imidazol-2-yl)methyl]aniline.
Molecular Properties
| Compound Name | 3-cyclopropyl-N-[(4,5-dimethyl-1H-imidazol-2-yl)methyl]aniline |
| PubChem CID | 166246305 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 3-cyclopropyl-N-[(4,5-dimethyl-1H-imidazol-2-yl)methyl]aniline |
| SMILES | Cc1nc(CNc2cccc(C3CC3)c2)[nH]c1C |
| InChI | InChI=1S/C15H19N3/c1-10-11(2)18-15(17-10)9-16-14-5-3-4-13(8-14)12-6-7-12/h3-5,8,12,16H,6-7,9H2,1-2H3,(H,17,18) |
| InChIKey | GAQLGPNXYBWTJD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-cyclopropyl-N-[(4,5-dimethyl-1H-imidazol-2-yl)methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyl-N-[(4,5-dimethyl-1H-imidazol-2-yl)methyl]aniline?
The IUPAC name of 3-cyclopropyl-N-[(4,5-dimethyl-1H-imidazol-2-yl)methyl]aniline (CID 166246305) is 3-cyclopropyl-N-[(4,5-dimethyl-1H-imidazol-2-yl)methyl]aniline.
What is the SMILES notation for 3-cyclopropyl-N-[(4,5-dimethyl-1H-imidazol-2-yl)methyl]aniline?
The canonical SMILES for 3-cyclopropyl-N-[(4,5-dimethyl-1H-imidazol-2-yl)methyl]aniline is Cc1nc(CNc2cccc(C3CC3)c2)[nH]c1C.
What is the InChIKey of 3-cyclopropyl-N-[(4,5-dimethyl-1H-imidazol-2-yl)methyl]aniline?
The InChIKey is GAQLGPNXYBWTJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3/c1-10-11(2)18-15(17-10)9-16-14-5-3-4-13(8-14)12-6-7-12/h3-5,8,12,16H,6-7,9H2,1-2H3,(H,17,18).
What are the key properties of 3-cyclopropyl-N-[(4,5-dimethyl-1H-imidazol-2-yl)methyl]aniline?
3-cyclopropyl-N-[(4,5-dimethyl-1H-imidazol-2-yl)methyl]aniline has a molecular weight of 241.34 g/mol, XLogP of 3.52, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-N-[(4,5-dimethyl-1H-imidazol-2-yl)methyl]aniline is sourced from PubChem (CID 166246305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).