About (3-oxo-1,2-dihydroinden-2-yl) (4S)-2-oxo-1,3-oxazolidine-4-carboxylate
(3-oxo-1,2-dihydroinden-2-yl) (4S)-2-oxo-1,3-oxazolidine-4-carboxylate (PubChem CID 166246456) has the molecular formula C13H11NO5
and a molecular weight of 261.23 g/mol. Its IUPAC name is (3-oxo-1,2-dihydroinden-2-yl) (4S)-2-oxo-1,3-oxazolidine-4-carboxylate.
Molecular Properties
| Compound Name | (3-oxo-1,2-dihydroinden-2-yl) (4S)-2-oxo-1,3-oxazolidine-4-carboxylate |
| PubChem CID | 166246456 |
| Molecular Formula | C13H11NO5 |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | (3-oxo-1,2-dihydroinden-2-yl) (4S)-2-oxo-1,3-oxazolidine-4-carboxylate |
| SMILES | O=C1N[C@H](C(=O)OC2Cc3ccccc3C2=O)CO1 |
| InChI | InChI=1S/C13H11NO5/c15-11-8-4-2-1-3-7(8)5-10(11)19-12(16)9-6-18-13(17)14-9/h1-4,9-10H,5-6H2,(H,14,17)/t9-,10?/m0/s1 |
| InChIKey | FLPFEUGPNDAMNF-RGURZIINSA-N |
| XLogP | 0.45 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-oxo-1,2-dihydroinden-2-yl) (4S)-2-oxo-1,3-oxazolidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-oxo-1,2-dihydroinden-2-yl) (4S)-2-oxo-1,3-oxazolidine-4-carboxylate?
The IUPAC name of (3-oxo-1,2-dihydroinden-2-yl) (4S)-2-oxo-1,3-oxazolidine-4-carboxylate (CID 166246456) is (3-oxo-1,2-dihydroinden-2-yl) (4S)-2-oxo-1,3-oxazolidine-4-carboxylate.
What is the SMILES notation for (3-oxo-1,2-dihydroinden-2-yl) (4S)-2-oxo-1,3-oxazolidine-4-carboxylate?
The canonical SMILES for (3-oxo-1,2-dihydroinden-2-yl) (4S)-2-oxo-1,3-oxazolidine-4-carboxylate is O=C1N[C@H](C(=O)OC2Cc3ccccc3C2=O)CO1.
What is the InChIKey of (3-oxo-1,2-dihydroinden-2-yl) (4S)-2-oxo-1,3-oxazolidine-4-carboxylate?
The InChIKey is FLPFEUGPNDAMNF-RGURZIINSA-N. The full InChI is InChI=1S/C13H11NO5/c15-11-8-4-2-1-3-7(8)5-10(11)19-12(16)9-6-18-13(17)14-9/h1-4,9-10H,5-6H2,(H,14,17)/t9-,10?/m0/s1.
What are the key properties of (3-oxo-1,2-dihydroinden-2-yl) (4S)-2-oxo-1,3-oxazolidine-4-carboxylate?
(3-oxo-1,2-dihydroinden-2-yl) (4S)-2-oxo-1,3-oxazolidine-4-carboxylate has a molecular weight of 261.23 g/mol, XLogP of 0.45, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-oxo-1,2-dihydroinden-2-yl) (4S)-2-oxo-1,3-oxazolidine-4-carboxylate is sourced from PubChem (CID 166246456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).