C12H13N5OS — CID 166246923
5-cyclopropyl-N-[(E)-(2-cyclopropyl-1,3-oxazol-5-yl)methylideneamino]-1,3,4-thiadiazol-2-amine (PubChem CID 166246923) has the molecular formula C12H13N5OS and a molecular weight of 275.34 g/mol. Its IUPAC name is 5-cyclopropyl-N-[(E)-(2-cyclopropyl-1,3-oxazol-5-yl)methylideneamino]-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-cyclopropyl-N-[(E)-(2-cyclopropyl-1,3-oxazol-5-yl)methylideneamino]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 166246923 |
| Molecular Formula | C12H13N5OS |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 5-cyclopropyl-N-[(E)-(2-cyclopropyl-1,3-oxazol-5-yl)methylideneamino]-1,3,4-thiadiazol-2-amine |
| SMILES | C(=N/Nc1nnc(C2CC2)s1)\c1cnc(C2CC2)o1 |
| InChI | InChI=1S/C12H13N5OS/c1-2-7(1)10-13-5-9(18-10)6-14-16-12-17-15-11(19-12)8-3-4-8/h5-8H,1-4H2,(H,16,17)/b14-6+ |
| InChIKey | LJXCATMEDPGKSM-MKMNVTDBSA-N |
| XLogP | 2.73 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|