About (1-cyanoindolizin-2-yl)methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate
(1-cyanoindolizin-2-yl)methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate (PubChem CID 16624698) has the molecular formula C25H13ClN2O4
and a molecular weight of 440.84 g/mol. Its IUPAC name is (1-cyanoindolizin-2-yl)methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate.
Molecular Properties
| Compound Name | (1-cyanoindolizin-2-yl)methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate |
| PubChem CID | 16624698 |
| Molecular Formula | C25H13ClN2O4 |
| Molecular Weight | 440.84 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | (1-cyanoindolizin-2-yl)methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate |
| SMILES | N#Cc1c(COC(=O)c2ccc3c(c2Cl)C(=O)c2ccccc2C3=O)cn2ccccc12 |
| InChI | InChI=1S/C25H13ClN2O4/c26-22-18(9-8-17-21(22)24(30)16-6-2-1-5-15(16)23(17)29)25(31)32-13-14-12-28-10-4-3-7-20(28)19(14)11-27/h1-10,12H,13H2 |
| InChIKey | FBBXOPREDUXAOG-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 88.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.84 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze (1-cyanoindolizin-2-yl)methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-cyanoindolizin-2-yl)methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate?
The IUPAC name of (1-cyanoindolizin-2-yl)methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate (CID 16624698) is (1-cyanoindolizin-2-yl)methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate.
What is the SMILES notation for (1-cyanoindolizin-2-yl)methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate?
The canonical SMILES for (1-cyanoindolizin-2-yl)methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate is N#Cc1c(COC(=O)c2ccc3c(c2Cl)C(=O)c2ccccc2C3=O)cn2ccccc12.
What is the InChIKey of (1-cyanoindolizin-2-yl)methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate?
The InChIKey is FBBXOPREDUXAOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H13ClN2O4/c26-22-18(9-8-17-21(22)24(30)16-6-2-1-5-15(16)23(17)29)25(31)32-13-14-12-28-10-4-3-7-20(28)19(14)11-27/h1-10,12H,13H2.
What are the key properties of (1-cyanoindolizin-2-yl)methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate?
(1-cyanoindolizin-2-yl)methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate has a molecular weight of 440.84 g/mol, XLogP of 4.60, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1-cyanoindolizin-2-yl)methyl 1-chloro-9,10-dioxoanthracene-2-carboxylate is sourced from PubChem (CID 16624698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).