C15H22N6OS — CID 166248132
3-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-1-methyl-1-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-3-ylmethyl)urea (PubChem CID 166248132) has the molecular formula C15H22N6OS and a molecular weight of 334.45 g/mol. Its IUPAC name is 3-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-1-methyl-1-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-3-ylmethyl)urea.
| Compound Name | 3-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-1-methyl-1-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 166248132 |
| Molecular Formula | C15H22N6OS |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 3-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-1-methyl-1-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-3-ylmethyl)urea |
| SMILES | Cc1nc(C)c(CNC(=O)N(C)Cc2cnn3c2CNCC3)s1 |
| InChI | InChI=1S/C15H22N6OS/c1-10-14(23-11(2)19-10)8-17-15(22)20(3)9-12-6-18-21-5-4-16-7-13(12)21/h6,16H,4-5,7-9H2,1-3H3,(H,17,22) |
| InChIKey | ARCJKAJPCFRAST-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |