C22H20N4O3 — CID 166249068
3a,6a-dimethyl-5-(3-naphthalen-2-yl-1H-pyrazole-5-carbonyl)-4,6-dihydropyrrolo[3,4-c]pyrrole-1,3-dione (PubChem CID 166249068) has the molecular formula C22H20N4O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is 3a,6a-dimethyl-5-(3-naphthalen-2-yl-1H-pyrazole-5-carbonyl)-4,6-dihydropyrrolo[3,4-c]pyrrole-1,3-dione.
| Compound Name | 3a,6a-dimethyl-5-(3-naphthalen-2-yl-1H-pyrazole-5-carbonyl)-4,6-dihydropyrrolo[3,4-c]pyrrole-1,3-dione |
|---|---|
| PubChem CID | 166249068 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 3a,6a-dimethyl-5-(3-naphthalen-2-yl-1H-pyrazole-5-carbonyl)-4,6-dihydropyrrolo[3,4-c]pyrrole-1,3-dione |
| SMILES | CC12CN(C(=O)c3cc(-c4ccc5ccccc5c4)n[nH]3)CC1(C)C(=O)NC2=O |
| InChI | InChI=1S/C22H20N4O3/c1-21-11-26(12-22(21,2)20(29)23-19(21)28)18(27)17-10-16(24-25-17)15-8-7-13-5-3-4-6-14(13)9-15/h3-10H,11-12H2,1-2H3,(H,24,25)(H,23,28,29) |
| InChIKey | MSLCQJMOYNNYED-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|