C12H14N2O4 — CID 166249928
(1S,5R)-5-[(5-methyl-1,2-oxazole-3-carbonyl)amino]cyclohex-3-ene-1-carboxylic acid (PubChem CID 166249928) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is (1S,5R)-5-[(5-methyl-1,2-oxazole-3-carbonyl)amino]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,5R)-5-[(5-methyl-1,2-oxazole-3-carbonyl)amino]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 166249928 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | (1S,5R)-5-[(5-methyl-1,2-oxazole-3-carbonyl)amino]cyclohex-3-ene-1-carboxylic acid |
| SMILES | Cc1cc(C(=O)N[C@H]2C=CC[C@H](C(=O)O)C2)no1 |
| InChI | InChI=1S/C12H14N2O4/c1-7-5-10(14-18-7)11(15)13-9-4-2-3-8(6-9)12(16)17/h2,4-5,8-9H,3,6H2,1H3,(H,13,15)(H,16,17)/t8-,9-/m0/s1 |
| InChIKey | INFHPYXCTRXBLQ-IUCAKERBSA-N |
| XLogP | 1.13 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|