C23H25N3O3 — CID 166250443
N-(2,5-dimethylphenyl)-N-(oxan-4-yl)-2-(4-oxo-3H-phthalazin-1-yl)acetamide (PubChem CID 166250443) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-N-(oxan-4-yl)-2-(4-oxo-3H-phthalazin-1-yl)acetamide.
| Compound Name | N-(2,5-dimethylphenyl)-N-(oxan-4-yl)-2-(4-oxo-3H-phthalazin-1-yl)acetamide |
|---|---|
| PubChem CID | 166250443 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | N-(2,5-dimethylphenyl)-N-(oxan-4-yl)-2-(4-oxo-3H-phthalazin-1-yl)acetamide |
| SMILES | Cc1ccc(C)c(N(C(=O)Cc2n[nH]c(=O)c3ccccc23)C2CCOCC2)c1 |
| InChI | InChI=1S/C23H25N3O3/c1-15-7-8-16(2)21(13-15)26(17-9-11-29-12-10-17)22(27)14-20-18-5-3-4-6-19(18)23(28)25-24-20/h3-8,13,17H,9-12,14H2,1-2H3,(H,25,28) |
| InChIKey | MVDYMPVZZDQQLU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |