C17H18F3N5O — CID 166250479
(3-methylpiperazin-1-yl)-[3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]methanone (PubChem CID 166250479) has the molecular formula C17H18F3N5O and a molecular weight of 365.36 g/mol. Its IUPAC name is (3-methylpiperazin-1-yl)-[3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]methanone.
| Compound Name | (3-methylpiperazin-1-yl)-[3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]methanone |
|---|---|
| PubChem CID | 166250479 |
| Molecular Formula | C17H18F3N5O |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | (3-methylpiperazin-1-yl)-[3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]methanone |
| SMILES | CC1CN(C(=O)c2cccc(Nc3nccc(C(F)(F)F)n3)c2)CCN1 |
| InChI | InChI=1S/C17H18F3N5O/c1-11-10-25(8-7-21-11)15(26)12-3-2-4-13(9-12)23-16-22-6-5-14(24-16)17(18,19)20/h2-6,9,11,21H,7-8,10H2,1H3,(H,22,23,24) |
| InChIKey | HDJGYALCIRAQAD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |