C15H21F3N4O — CID 166251137
6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-7-yl-[4-(2,2,2-trifluoroethyl)piperidin-1-yl]methanone (PubChem CID 166251137) has the molecular formula C15H21F3N4O and a molecular weight of 330.35 g/mol. Its IUPAC name is 6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-7-yl-[4-(2,2,2-trifluoroethyl)piperidin-1-yl]methanone.
| Compound Name | 6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-7-yl-[4-(2,2,2-trifluoroethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 166251137 |
| Molecular Formula | C15H21F3N4O |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-7-yl-[4-(2,2,2-trifluoroethyl)piperidin-1-yl]methanone |
| SMILES | O=C(C1CCc2nncn2CC1)N1CCC(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C15H21F3N4O/c16-15(17,18)9-11-3-6-21(7-4-11)14(23)12-1-2-13-20-19-10-22(13)8-5-12/h10-12H,1-9H2 |
| InChIKey | YAQZZIIJDOMGAV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |