C21H22N2O4 — CID 166251959
2-[[[2-oxo-2-(1,2,3,4-tetrahydronaphthalen-2-ylmethylamino)acetyl]amino]methyl]benzoic acid (PubChem CID 166251959) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is 2-[[[2-oxo-2-(1,2,3,4-tetrahydronaphthalen-2-ylmethylamino)acetyl]amino]methyl]benzoic acid.
| Compound Name | 2-[[[2-oxo-2-(1,2,3,4-tetrahydronaphthalen-2-ylmethylamino)acetyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 166251959 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 2-[[[2-oxo-2-(1,2,3,4-tetrahydronaphthalen-2-ylmethylamino)acetyl]amino]methyl]benzoic acid |
| SMILES | O=C(NCc1ccccc1C(=O)O)C(=O)NCC1CCc2ccccc2C1 |
| InChI | InChI=1S/C21H22N2O4/c24-19(20(25)23-13-17-7-3-4-8-18(17)21(26)27)22-12-14-9-10-15-5-1-2-6-16(15)11-14/h1-8,14H,9-13H2,(H,22,24)(H,23,25)(H,26,27) |
| InChIKey | OYBOMGDZKKTMJB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|