About 2-[[[2-[3-(4-methyl-1,3-thiazol-2-yl)pyrrolidin-1-yl]-2-oxoacetyl]amino]methyl]benzoic acid
2-[[[2-[3-(4-methyl-1,3-thiazol-2-yl)pyrrolidin-1-yl]-2-oxoacetyl]amino]methyl]benzoic acid (PubChem CID 166251962) has the molecular formula C18H19N3O4S
and a molecular weight of 373.43 g/mol. Its IUPAC name is 2-[[[2-[3-(4-methyl-1,3-thiazol-2-yl)pyrrolidin-1-yl]-2-oxoacetyl]amino]methyl]benzoic acid.
Molecular Properties
| Compound Name | 2-[[[2-[3-(4-methyl-1,3-thiazol-2-yl)pyrrolidin-1-yl]-2-oxoacetyl]amino]methyl]benzoic acid |
| PubChem CID | 166251962 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 2-[[[2-[3-(4-methyl-1,3-thiazol-2-yl)pyrrolidin-1-yl]-2-oxoacetyl]amino]methyl]benzoic acid |
| SMILES | Cc1csc(C2CCN(C(=O)C(=O)NCc3ccccc3C(=O)O)C2)n1 |
| InChI | InChI=1S/C18H19N3O4S/c1-11-10-26-16(20-11)13-6-7-21(9-13)17(23)15(22)19-8-12-4-2-3-5-14(12)18(24)25/h2-5,10,13H,6-9H2,1H3,(H,19,22)(H,24,25) |
| InChIKey | URZNHALGOKYJGB-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[[[2-[3-(4-methyl-1,3-thiazol-2-yl)pyrrolidin-1-yl]-2-oxoacetyl]amino]methyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[[2-[3-(4-methyl-1,3-thiazol-2-yl)pyrrolidin-1-yl]-2-oxoacetyl]amino]methyl]benzoic acid?
The IUPAC name of 2-[[[2-[3-(4-methyl-1,3-thiazol-2-yl)pyrrolidin-1-yl]-2-oxoacetyl]amino]methyl]benzoic acid (CID 166251962) is 2-[[[2-[3-(4-methyl-1,3-thiazol-2-yl)pyrrolidin-1-yl]-2-oxoacetyl]amino]methyl]benzoic acid.
What is the SMILES notation for 2-[[[2-[3-(4-methyl-1,3-thiazol-2-yl)pyrrolidin-1-yl]-2-oxoacetyl]amino]methyl]benzoic acid?
The canonical SMILES for 2-[[[2-[3-(4-methyl-1,3-thiazol-2-yl)pyrrolidin-1-yl]-2-oxoacetyl]amino]methyl]benzoic acid is Cc1csc(C2CCN(C(=O)C(=O)NCc3ccccc3C(=O)O)C2)n1.
What is the InChIKey of 2-[[[2-[3-(4-methyl-1,3-thiazol-2-yl)pyrrolidin-1-yl]-2-oxoacetyl]amino]methyl]benzoic acid?
The InChIKey is URZNHALGOKYJGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3O4S/c1-11-10-26-16(20-11)13-6-7-21(9-13)17(23)15(22)19-8-12-4-2-3-5-14(12)18(24)25/h2-5,10,13H,6-9H2,1H3,(H,19,22)(H,24,25).
What are the key properties of 2-[[[2-[3-(4-methyl-1,3-thiazol-2-yl)pyrrolidin-1-yl]-2-oxoacetyl]amino]methyl]benzoic acid?
2-[[[2-[3-(4-methyl-1,3-thiazol-2-yl)pyrrolidin-1-yl]-2-oxoacetyl]amino]methyl]benzoic acid has a molecular weight of 373.43 g/mol, XLogP of 1.78, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[[2-[3-(4-methyl-1,3-thiazol-2-yl)pyrrolidin-1-yl]-2-oxoacetyl]amino]methyl]benzoic acid is sourced from PubChem (CID 166251962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).