About (3-hydroxycyclobutyl)methyl 4-chlorothieno[2,3-c]pyridine-2-carboxylate
(3-hydroxycyclobutyl)methyl 4-chlorothieno[2,3-c]pyridine-2-carboxylate (PubChem CID 166252037) has the molecular formula C13H12ClNO3S
and a molecular weight of 297.76 g/mol. Its IUPAC name is (3-hydroxycyclobutyl)methyl 4-chlorothieno[2,3-c]pyridine-2-carboxylate.
Molecular Properties
| Compound Name | (3-hydroxycyclobutyl)methyl 4-chlorothieno[2,3-c]pyridine-2-carboxylate |
| PubChem CID | 166252037 |
| Molecular Formula | C13H12ClNO3S |
| Molecular Weight | 297.76 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | (3-hydroxycyclobutyl)methyl 4-chlorothieno[2,3-c]pyridine-2-carboxylate |
| SMILES | O=C(OCC1CC(O)C1)c1cc2c(Cl)cncc2s1 |
| InChI | InChI=1S/C13H12ClNO3S/c14-10-4-15-5-12-9(10)3-11(19-12)13(17)18-6-7-1-8(16)2-7/h3-5,7-8,16H,1-2,6H2 |
| InChIKey | KGEHRQBPDLCPDU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.76 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-hydroxycyclobutyl)methyl 4-chlorothieno[2,3-c]pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxycyclobutyl)methyl 4-chlorothieno[2,3-c]pyridine-2-carboxylate?
The IUPAC name of (3-hydroxycyclobutyl)methyl 4-chlorothieno[2,3-c]pyridine-2-carboxylate (CID 166252037) is (3-hydroxycyclobutyl)methyl 4-chlorothieno[2,3-c]pyridine-2-carboxylate.
What is the SMILES notation for (3-hydroxycyclobutyl)methyl 4-chlorothieno[2,3-c]pyridine-2-carboxylate?
The canonical SMILES for (3-hydroxycyclobutyl)methyl 4-chlorothieno[2,3-c]pyridine-2-carboxylate is O=C(OCC1CC(O)C1)c1cc2c(Cl)cncc2s1.
What is the InChIKey of (3-hydroxycyclobutyl)methyl 4-chlorothieno[2,3-c]pyridine-2-carboxylate?
The InChIKey is KGEHRQBPDLCPDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12ClNO3S/c14-10-4-15-5-12-9(10)3-11(19-12)13(17)18-6-7-1-8(16)2-7/h3-5,7-8,16H,1-2,6H2.
What are the key properties of (3-hydroxycyclobutyl)methyl 4-chlorothieno[2,3-c]pyridine-2-carboxylate?
(3-hydroxycyclobutyl)methyl 4-chlorothieno[2,3-c]pyridine-2-carboxylate has a molecular weight of 297.76 g/mol, XLogP of 2.88, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxycyclobutyl)methyl 4-chlorothieno[2,3-c]pyridine-2-carboxylate is sourced from PubChem (CID 166252037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).