About ethyl 5-(4-acetylthiophene-2-carbonyl)-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-2-carboxylate
ethyl 5-(4-acetylthiophene-2-carbonyl)-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-2-carboxylate (PubChem CID 166252580) has the molecular formula C17H19N3O4S
and a molecular weight of 361.42 g/mol. Its IUPAC name is ethyl 5-(4-acetylthiophene-2-carbonyl)-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-(4-acetylthiophene-2-carbonyl)-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-2-carboxylate |
| PubChem CID | 166252580 |
| Molecular Formula | C17H19N3O4S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | ethyl 5-(4-acetylthiophene-2-carbonyl)-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-2-carboxylate |
| SMILES | CCOC(=O)c1cc2n(n1)CC(C)N(C(=O)c1cc(C(C)=O)cs1)C2 |
| InChI | InChI=1S/C17H19N3O4S/c1-4-24-17(23)14-6-13-8-19(10(2)7-20(13)18-14)16(22)15-5-12(9-25-15)11(3)21/h5-6,9-10H,4,7-8H2,1-3H3 |
| InChIKey | REDKBFFMNFHMHD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 5-(4-acetylthiophene-2-carbonyl)-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(4-acetylthiophene-2-carbonyl)-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-2-carboxylate?
The IUPAC name of ethyl 5-(4-acetylthiophene-2-carbonyl)-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-2-carboxylate (CID 166252580) is ethyl 5-(4-acetylthiophene-2-carbonyl)-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-2-carboxylate.
What is the SMILES notation for ethyl 5-(4-acetylthiophene-2-carbonyl)-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-2-carboxylate?
The canonical SMILES for ethyl 5-(4-acetylthiophene-2-carbonyl)-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-2-carboxylate is CCOC(=O)c1cc2n(n1)CC(C)N(C(=O)c1cc(C(C)=O)cs1)C2.
What is the InChIKey of ethyl 5-(4-acetylthiophene-2-carbonyl)-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-2-carboxylate?
The InChIKey is REDKBFFMNFHMHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3O4S/c1-4-24-17(23)14-6-13-8-19(10(2)7-20(13)18-14)16(22)15-5-12(9-25-15)11(3)21/h5-6,9-10H,4,7-8H2,1-3H3.
What are the key properties of ethyl 5-(4-acetylthiophene-2-carbonyl)-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-2-carboxylate?
ethyl 5-(4-acetylthiophene-2-carbonyl)-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-2-carboxylate has a molecular weight of 361.42 g/mol, XLogP of 2.37, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(4-acetylthiophene-2-carbonyl)-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-2-carboxylate is sourced from PubChem (CID 166252580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).