C22H22FN3O2 — CID 166253630
4-[[2-[(4-fluorophenyl)methyl]pyrrolidin-1-yl]methyl]-1-phenylpyrazole-3-carboxylic acid (PubChem CID 166253630) has the molecular formula C22H22FN3O2 and a molecular weight of 379.44 g/mol. Its IUPAC name is 4-[[2-[(4-fluorophenyl)methyl]pyrrolidin-1-yl]methyl]-1-phenylpyrazole-3-carboxylic acid.
| Compound Name | 4-[[2-[(4-fluorophenyl)methyl]pyrrolidin-1-yl]methyl]-1-phenylpyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 166253630 |
| Molecular Formula | C22H22FN3O2 |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 4-[[2-[(4-fluorophenyl)methyl]pyrrolidin-1-yl]methyl]-1-phenylpyrazole-3-carboxylic acid |
| SMILES | O=C(O)c1nn(-c2ccccc2)cc1CN1CCCC1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C22H22FN3O2/c23-18-10-8-16(9-11-18)13-20-7-4-12-25(20)14-17-15-26(24-21(17)22(27)28)19-5-2-1-3-6-19/h1-3,5-6,8-11,15,20H,4,7,12-14H2,(H,27,28) |
| InChIKey | XMEQWCYTXWPQMW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |