About 2-bromo-N'-[(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)methoxy]benzenecarboximidamide
2-bromo-N'-[(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)methoxy]benzenecarboximidamide (PubChem CID 166253645) has the molecular formula C14H15BrF2N2O
and a molecular weight of 345.19 g/mol. Its IUPAC name is 2-bromo-N'-[(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)methoxy]benzenecarboximidamide.
Molecular Properties
| Compound Name | 2-bromo-N'-[(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)methoxy]benzenecarboximidamide |
| PubChem CID | 166253645 |
| Molecular Formula | C14H15BrF2N2O |
| Molecular Weight | 345.19 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | 2-bromo-N'-[(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)methoxy]benzenecarboximidamide |
| SMILES | N/C(=N\OCC1CC2C(C1)C2(F)F)c1ccccc1Br |
| InChI | InChI=1S/C14H15BrF2N2O/c15-12-4-2-1-3-9(12)13(18)19-20-7-8-5-10-11(6-8)14(10,16)17/h1-4,8,10-11H,5-7H2,(H2,18,19) |
| InChIKey | VUHOYYXKRRJTFP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.19 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-N'-[(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)methoxy]benzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N'-[(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)methoxy]benzenecarboximidamide?
The IUPAC name of 2-bromo-N'-[(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)methoxy]benzenecarboximidamide (CID 166253645) is 2-bromo-N'-[(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)methoxy]benzenecarboximidamide.
What is the SMILES notation for 2-bromo-N'-[(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)methoxy]benzenecarboximidamide?
The canonical SMILES for 2-bromo-N'-[(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)methoxy]benzenecarboximidamide is N/C(=N\OCC1CC2C(C1)C2(F)F)c1ccccc1Br.
What is the InChIKey of 2-bromo-N'-[(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)methoxy]benzenecarboximidamide?
The InChIKey is VUHOYYXKRRJTFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15BrF2N2O/c15-12-4-2-1-3-9(12)13(18)19-20-7-8-5-10-11(6-8)14(10,16)17/h1-4,8,10-11H,5-7H2,(H2,18,19).
What are the key properties of 2-bromo-N'-[(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)methoxy]benzenecarboximidamide?
2-bromo-N'-[(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)methoxy]benzenecarboximidamide has a molecular weight of 345.19 g/mol, XLogP of 3.38, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N'-[(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)methoxy]benzenecarboximidamide is sourced from PubChem (CID 166253645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).