C16H17N3O2S2 — CID 166254984
5-[(1-methylimidazol-2-yl)sulfanylmethyl]-N-prop-2-ynyl-N-(thietan-3-yl)furan-2-carboxamide (PubChem CID 166254984) has the molecular formula C16H17N3O2S2 and a molecular weight of 347.47 g/mol. Its IUPAC name is 5-[(1-methylimidazol-2-yl)sulfanylmethyl]-N-prop-2-ynyl-N-(thietan-3-yl)furan-2-carboxamide.
| Compound Name | 5-[(1-methylimidazol-2-yl)sulfanylmethyl]-N-prop-2-ynyl-N-(thietan-3-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 166254984 |
| Molecular Formula | C16H17N3O2S2 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 5-[(1-methylimidazol-2-yl)sulfanylmethyl]-N-prop-2-ynyl-N-(thietan-3-yl)furan-2-carboxamide |
| SMILES | C#CCN(C(=O)c1ccc(CSc2nccn2C)o1)C1CSC1 |
| InChI | InChI=1S/C16H17N3O2S2/c1-3-7-19(12-9-22-10-12)15(20)14-5-4-13(21-14)11-23-16-17-6-8-18(16)2/h1,4-6,8,12H,7,9-11H2,2H3 |
| InChIKey | TZXFBSYYXZLQBC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 51.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|