C17H20N2O2S — CID 166255223
2-[[(3aS,7aS)-2-oxo-3,3a,4,5,6,7-hexahydro-1-benzofuran-7a-yl]methylsulfanyl]-4,6-dimethylpyridine-3-carbonitrile (PubChem CID 166255223) has the molecular formula C17H20N2O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is 2-[[(3aS,7aS)-2-oxo-3,3a,4,5,6,7-hexahydro-1-benzofuran-7a-yl]methylsulfanyl]-4,6-dimethylpyridine-3-carbonitrile.
| Compound Name | 2-[[(3aS,7aS)-2-oxo-3,3a,4,5,6,7-hexahydro-1-benzofuran-7a-yl]methylsulfanyl]-4,6-dimethylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 166255223 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 2-[[(3aS,7aS)-2-oxo-3,3a,4,5,6,7-hexahydro-1-benzofuran-7a-yl]methylsulfanyl]-4,6-dimethylpyridine-3-carbonitrile |
| SMILES | Cc1cc(C)c(C#N)c(SC[C@]23CCCC[C@H]2CC(=O)O3)n1 |
| InChI | InChI=1S/C17H20N2O2S/c1-11-7-12(2)19-16(14(11)9-18)22-10-17-6-4-3-5-13(17)8-15(20)21-17/h7,13H,3-6,8,10H2,1-2H3/t13-,17+/m0/s1 |
| InChIKey | GOPKIVDFAHWHPJ-SUMWQHHRSA-N |
| XLogP | 3.54 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |