C16H21BrN2O — CID 166255783
[(3aR,7aS)-6-methyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-1-yl]-(3-bromo-2-methylphenyl)methanone (PubChem CID 166255783) has the molecular formula C16H21BrN2O and a molecular weight of 337.26 g/mol. Its IUPAC name is [(3aR,7aS)-6-methyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-1-yl]-(3-bromo-2-methylphenyl)methanone.
| Compound Name | [(3aR,7aS)-6-methyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-1-yl]-(3-bromo-2-methylphenyl)methanone |
|---|---|
| PubChem CID | 166255783 |
| Molecular Formula | C16H21BrN2O |
| Molecular Weight | 337.26 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | [(3aR,7aS)-6-methyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-1-yl]-(3-bromo-2-methylphenyl)methanone |
| SMILES | Cc1c(Br)cccc1C(=O)N1CC[C@H]2CCN(C)C[C@H]21 |
| InChI | InChI=1S/C16H21BrN2O/c1-11-13(4-3-5-14(11)17)16(20)19-9-7-12-6-8-18(2)10-15(12)19/h3-5,12,15H,6-10H2,1-2H3/t12-,15-/m1/s1 |
| InChIKey | XLRCYTRJKJSKCI-IUODEOHRSA-N |
| XLogP | 2.92 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.26 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |