C15H13Cl2N3O4S — CID 166255891
6-[(3,5-dichloro-2-hydroxyphenyl)sulfonylamino]-2,3-dihydroindole-1-carboxamide (PubChem CID 166255891) has the molecular formula C15H13Cl2N3O4S and a molecular weight of 402.26 g/mol. Its IUPAC name is 6-[(3,5-dichloro-2-hydroxyphenyl)sulfonylamino]-2,3-dihydroindole-1-carboxamide.
| Compound Name | 6-[(3,5-dichloro-2-hydroxyphenyl)sulfonylamino]-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 166255891 |
| Molecular Formula | C15H13Cl2N3O4S |
| Molecular Weight | 402.26 g/mol |
| Exact Mass | 401.00 |
| IUPAC Name | 6-[(3,5-dichloro-2-hydroxyphenyl)sulfonylamino]-2,3-dihydroindole-1-carboxamide |
| SMILES | NC(=O)N1CCc2ccc(NS(=O)(=O)c3cc(Cl)cc(Cl)c3O)cc21 |
| InChI | InChI=1S/C15H13Cl2N3O4S/c16-9-5-11(17)14(21)13(6-9)25(23,24)19-10-2-1-8-3-4-20(15(18)22)12(8)7-10/h1-2,5-7,19,21H,3-4H2,(H2,18,22) |
| InChIKey | FEBBEEKWSFTQDP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.26 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|