C12H18BrN3O2S — CID 166256385
N-[2-[2-(5-bromo-3-pyridinyl)pyrrolidin-1-yl]ethyl]methanesulfonamide (PubChem CID 166256385) has the molecular formula C12H18BrN3O2S and a molecular weight of 348.27 g/mol. Its IUPAC name is N-[2-[2-(5-bromo-3-pyridinyl)pyrrolidin-1-yl]ethyl]methanesulfonamide.
| Compound Name | N-[2-[2-(5-bromo-3-pyridinyl)pyrrolidin-1-yl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 166256385 |
| Molecular Formula | C12H18BrN3O2S |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | N-[2-[2-(5-bromo-3-pyridinyl)pyrrolidin-1-yl]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCN1CCCC1c1cncc(Br)c1 |
| InChI | InChI=1S/C12H18BrN3O2S/c1-19(17,18)15-4-6-16-5-2-3-12(16)10-7-11(13)9-14-8-10/h7-9,12,15H,2-6H2,1H3 |
| InChIKey | DJQBDWPCUCBLAJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |