C20H25FN4O3 — CID 166256482
2-[4-[2-(6-bicyclo[3.2.0]heptanylamino)-2-oxoacetyl]piperazin-1-yl]-5-fluorobenzamide (PubChem CID 166256482) has the molecular formula C20H25FN4O3 and a molecular weight of 388.44 g/mol. Its IUPAC name is 2-[4-[2-(6-bicyclo[3.2.0]heptanylamino)-2-oxoacetyl]piperazin-1-yl]-5-fluorobenzamide.
| Compound Name | 2-[4-[2-(6-bicyclo[3.2.0]heptanylamino)-2-oxoacetyl]piperazin-1-yl]-5-fluorobenzamide |
|---|---|
| PubChem CID | 166256482 |
| Molecular Formula | C20H25FN4O3 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 2-[4-[2-(6-bicyclo[3.2.0]heptanylamino)-2-oxoacetyl]piperazin-1-yl]-5-fluorobenzamide |
| SMILES | NC(=O)c1cc(F)ccc1N1CCN(C(=O)C(=O)NC2CC3CCCC32)CC1 |
| InChI | InChI=1S/C20H25FN4O3/c21-13-4-5-17(15(11-13)18(22)26)24-6-8-25(9-7-24)20(28)19(27)23-16-10-12-2-1-3-14(12)16/h4-5,11-12,14,16H,1-3,6-10H2,(H2,22,26)(H,23,27) |
| InChIKey | LIQNZAYQKJZQHE-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|