C22H22N2O3 — CID 166256570
3-[2-(1-benzyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]pyrrolidine-2,5-dione (PubChem CID 166256570) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is 3-[2-(1-benzyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]pyrrolidine-2,5-dione.
| Compound Name | 3-[2-(1-benzyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 166256570 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 3-[2-(1-benzyl-3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CC(CC(=O)N2CCc3ccccc3C2Cc2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C22H22N2O3/c25-20-13-17(22(27)23-20)14-21(26)24-11-10-16-8-4-5-9-18(16)19(24)12-15-6-2-1-3-7-15/h1-9,17,19H,10-14H2,(H,23,25,27) |
| InChIKey | OIPYBLMAMFFXOX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|