About (2-ethyl-1H-imidazo[4,5-b]pyridin-7-yl)-(2-methyl-4-pyridin-4-ylpiperazin-1-yl)methanone
(2-ethyl-1H-imidazo[4,5-b]pyridin-7-yl)-(2-methyl-4-pyridin-4-ylpiperazin-1-yl)methanone (PubChem CID 166256791) has the molecular formula C19H22N6O
and a molecular weight of 350.43 g/mol. Its IUPAC name is (2-ethyl-1H-imidazo[4,5-b]pyridin-7-yl)-(2-methyl-4-pyridin-4-ylpiperazin-1-yl)methanone.
Molecular Properties
| Compound Name | (2-ethyl-1H-imidazo[4,5-b]pyridin-7-yl)-(2-methyl-4-pyridin-4-ylpiperazin-1-yl)methanone |
| PubChem CID | 166256791 |
| Molecular Formula | C19H22N6O |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | (2-ethyl-1H-imidazo[4,5-b]pyridin-7-yl)-(2-methyl-4-pyridin-4-ylpiperazin-1-yl)methanone |
| SMILES | CCc1nc2nccc(C(=O)N3CCN(c4ccncc4)CC3C)c2[nH]1 |
| InChI | InChI=1S/C19H22N6O/c1-3-16-22-17-15(6-9-21-18(17)23-16)19(26)25-11-10-24(12-13(25)2)14-4-7-20-8-5-14/h4-9,13H,3,10-12H2,1-2H3,(H,21,22,23) |
| InChIKey | LMTQYZIDDOLERL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-ethyl-1H-imidazo[4,5-b]pyridin-7-yl)-(2-methyl-4-pyridin-4-ylpiperazin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethyl-1H-imidazo[4,5-b]pyridin-7-yl)-(2-methyl-4-pyridin-4-ylpiperazin-1-yl)methanone?
The IUPAC name of (2-ethyl-1H-imidazo[4,5-b]pyridin-7-yl)-(2-methyl-4-pyridin-4-ylpiperazin-1-yl)methanone (CID 166256791) is (2-ethyl-1H-imidazo[4,5-b]pyridin-7-yl)-(2-methyl-4-pyridin-4-ylpiperazin-1-yl)methanone.
What is the SMILES notation for (2-ethyl-1H-imidazo[4,5-b]pyridin-7-yl)-(2-methyl-4-pyridin-4-ylpiperazin-1-yl)methanone?
The canonical SMILES for (2-ethyl-1H-imidazo[4,5-b]pyridin-7-yl)-(2-methyl-4-pyridin-4-ylpiperazin-1-yl)methanone is CCc1nc2nccc(C(=O)N3CCN(c4ccncc4)CC3C)c2[nH]1.
What is the InChIKey of (2-ethyl-1H-imidazo[4,5-b]pyridin-7-yl)-(2-methyl-4-pyridin-4-ylpiperazin-1-yl)methanone?
The InChIKey is LMTQYZIDDOLERL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N6O/c1-3-16-22-17-15(6-9-21-18(17)23-16)19(26)25-11-10-24(12-13(25)2)14-4-7-20-8-5-14/h4-9,13H,3,10-12H2,1-2H3,(H,21,22,23).
What are the key properties of (2-ethyl-1H-imidazo[4,5-b]pyridin-7-yl)-(2-methyl-4-pyridin-4-ylpiperazin-1-yl)methanone?
(2-ethyl-1H-imidazo[4,5-b]pyridin-7-yl)-(2-methyl-4-pyridin-4-ylpiperazin-1-yl)methanone has a molecular weight of 350.43 g/mol, XLogP of 2.27, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethyl-1H-imidazo[4,5-b]pyridin-7-yl)-(2-methyl-4-pyridin-4-ylpiperazin-1-yl)methanone is sourced from PubChem (CID 166256791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).