C16H25NO3S — CID 166257644
(3aR,6aS)-5-[(5-tert-butyl-2-methylfuran-3-yl)methyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrole 2,2-dioxide (PubChem CID 166257644) has the molecular formula C16H25NO3S and a molecular weight of 311.45 g/mol. Its IUPAC name is (3aR,6aS)-5-[(5-tert-butyl-2-methylfuran-3-yl)methyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrole 2,2-dioxide.
| Compound Name | (3aR,6aS)-5-[(5-tert-butyl-2-methylfuran-3-yl)methyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrole 2,2-dioxide |
|---|---|
| PubChem CID | 166257644 |
| Molecular Formula | C16H25NO3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | (3aR,6aS)-5-[(5-tert-butyl-2-methylfuran-3-yl)methyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrole 2,2-dioxide |
| SMILES | Cc1oc(C(C)(C)C)cc1CN1C[C@@H]2CS(=O)(=O)C[C@@H]2C1 |
| InChI | InChI=1S/C16H25NO3S/c1-11-12(5-15(20-11)16(2,3)4)6-17-7-13-9-21(18,19)10-14(13)8-17/h5,13-14H,6-10H2,1-4H3/t13-,14+ |
| InChIKey | FRPQDADXNJDJDU-OKILXGFUSA-N |
| XLogP | 2.36 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |