C22H27N3O2 — CID 166257658
(3-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-(3-phenyl-6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazin-1-yl)methanone (PubChem CID 166257658) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is (3-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-(3-phenyl-6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazin-1-yl)methanone.
| Compound Name | (3-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-(3-phenyl-6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazin-1-yl)methanone |
|---|---|
| PubChem CID | 166257658 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | (3-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-(3-phenyl-6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazin-1-yl)methanone |
| SMILES | CC1CN(C(=O)c2nc(-c3ccccc3)n3c2COCC3)C2CCCCC12 |
| InChI | InChI=1S/C22H27N3O2/c1-15-13-25(18-10-6-5-9-17(15)18)22(26)20-19-14-27-12-11-24(19)21(23-20)16-7-3-2-4-8-16/h2-4,7-8,15,17-18H,5-6,9-14H2,1H3 |
| InChIKey | DICMFQAIXWORHD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |