About [2-(2-amino-2,3-dihydro-1H-inden-5-yl)-4-fluorophenyl]methanol
[2-(2-amino-2,3-dihydro-1H-inden-5-yl)-4-fluorophenyl]methanol (PubChem CID 166257830) has the molecular formula C16H16FNO
and a molecular weight of 257.31 g/mol. Its IUPAC name is [2-(2-amino-2,3-dihydro-1H-inden-5-yl)-4-fluorophenyl]methanol.
Molecular Properties
| Compound Name | [2-(2-amino-2,3-dihydro-1H-inden-5-yl)-4-fluorophenyl]methanol |
| PubChem CID | 166257830 |
| Molecular Formula | C16H16FNO |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | [2-(2-amino-2,3-dihydro-1H-inden-5-yl)-4-fluorophenyl]methanol |
| SMILES | NC1Cc2ccc(-c3cc(F)ccc3CO)cc2C1 |
| InChI | InChI=1S/C16H16FNO/c17-14-4-3-12(9-19)16(8-14)11-2-1-10-6-15(18)7-13(10)5-11/h1-5,8,15,19H,6-7,9,18H2 |
| InChIKey | POOWVVRZVOLPBI-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [2-(2-amino-2,3-dihydro-1H-inden-5-yl)-4-fluorophenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-amino-2,3-dihydro-1H-inden-5-yl)-4-fluorophenyl]methanol?
The IUPAC name of [2-(2-amino-2,3-dihydro-1H-inden-5-yl)-4-fluorophenyl]methanol (CID 166257830) is [2-(2-amino-2,3-dihydro-1H-inden-5-yl)-4-fluorophenyl]methanol.
What is the SMILES notation for [2-(2-amino-2,3-dihydro-1H-inden-5-yl)-4-fluorophenyl]methanol?
The canonical SMILES for [2-(2-amino-2,3-dihydro-1H-inden-5-yl)-4-fluorophenyl]methanol is NC1Cc2ccc(-c3cc(F)ccc3CO)cc2C1.
What is the InChIKey of [2-(2-amino-2,3-dihydro-1H-inden-5-yl)-4-fluorophenyl]methanol?
The InChIKey is POOWVVRZVOLPBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16FNO/c17-14-4-3-12(9-19)16(8-14)11-2-1-10-6-15(18)7-13(10)5-11/h1-5,8,15,19H,6-7,9,18H2.
What are the key properties of [2-(2-amino-2,3-dihydro-1H-inden-5-yl)-4-fluorophenyl]methanol?
[2-(2-amino-2,3-dihydro-1H-inden-5-yl)-4-fluorophenyl]methanol has a molecular weight of 257.31 g/mol, XLogP of 2.41, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-amino-2,3-dihydro-1H-inden-5-yl)-4-fluorophenyl]methanol is sourced from PubChem (CID 166257830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).