About 1-[(1S,2R)-2-[[2-(5-methylthiophen-2-yl)acetyl]amino]cyclohexyl]triazole-4-carboxylic acid
1-[(1S,2R)-2-[[2-(5-methylthiophen-2-yl)acetyl]amino]cyclohexyl]triazole-4-carboxylic acid (PubChem CID 166258863) has the molecular formula C16H20N4O3S
and a molecular weight of 348.43 g/mol. Its IUPAC name is 1-[(1S,2R)-2-[[2-(5-methylthiophen-2-yl)acetyl]amino]cyclohexyl]triazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-[(1S,2R)-2-[[2-(5-methylthiophen-2-yl)acetyl]amino]cyclohexyl]triazole-4-carboxylic acid |
| PubChem CID | 166258863 |
| Molecular Formula | C16H20N4O3S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 1-[(1S,2R)-2-[[2-(5-methylthiophen-2-yl)acetyl]amino]cyclohexyl]triazole-4-carboxylic acid |
| SMILES | Cc1ccc(CC(=O)N[C@@H]2CCCC[C@@H]2n2cc(C(=O)O)nn2)s1 |
| InChI | InChI=1S/C16H20N4O3S/c1-10-6-7-11(24-10)8-15(21)17-12-4-2-3-5-14(12)20-9-13(16(22)23)18-19-20/h6-7,9,12,14H,2-5,8H2,1H3,(H,17,21)(H,22,23)/t12-,14+/m1/s1 |
| InChIKey | UXRGYOCEIZOHQB-OCCSQVGLSA-N |
| XLogP | 2.19 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(1S,2R)-2-[[2-(5-methylthiophen-2-yl)acetyl]amino]cyclohexyl]triazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S,2R)-2-[[2-(5-methylthiophen-2-yl)acetyl]amino]cyclohexyl]triazole-4-carboxylic acid?
The IUPAC name of 1-[(1S,2R)-2-[[2-(5-methylthiophen-2-yl)acetyl]amino]cyclohexyl]triazole-4-carboxylic acid (CID 166258863) is 1-[(1S,2R)-2-[[2-(5-methylthiophen-2-yl)acetyl]amino]cyclohexyl]triazole-4-carboxylic acid.
What is the SMILES notation for 1-[(1S,2R)-2-[[2-(5-methylthiophen-2-yl)acetyl]amino]cyclohexyl]triazole-4-carboxylic acid?
The canonical SMILES for 1-[(1S,2R)-2-[[2-(5-methylthiophen-2-yl)acetyl]amino]cyclohexyl]triazole-4-carboxylic acid is Cc1ccc(CC(=O)N[C@@H]2CCCC[C@@H]2n2cc(C(=O)O)nn2)s1.
What is the InChIKey of 1-[(1S,2R)-2-[[2-(5-methylthiophen-2-yl)acetyl]amino]cyclohexyl]triazole-4-carboxylic acid?
The InChIKey is UXRGYOCEIZOHQB-OCCSQVGLSA-N. The full InChI is InChI=1S/C16H20N4O3S/c1-10-6-7-11(24-10)8-15(21)17-12-4-2-3-5-14(12)20-9-13(16(22)23)18-19-20/h6-7,9,12,14H,2-5,8H2,1H3,(H,17,21)(H,22,23)/t12-,14+/m1/s1.
What are the key properties of 1-[(1S,2R)-2-[[2-(5-methylthiophen-2-yl)acetyl]amino]cyclohexyl]triazole-4-carboxylic acid?
1-[(1S,2R)-2-[[2-(5-methylthiophen-2-yl)acetyl]amino]cyclohexyl]triazole-4-carboxylic acid has a molecular weight of 348.43 g/mol, XLogP of 2.19, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S,2R)-2-[[2-(5-methylthiophen-2-yl)acetyl]amino]cyclohexyl]triazole-4-carboxylic acid is sourced from PubChem (CID 166258863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).