About N-(1-cyanopropan-2-yl)-9-methoxy-N-methyl-3,5-dihydro-2H-1,4-benzoxazepine-4-sulfonamide
N-(1-cyanopropan-2-yl)-9-methoxy-N-methyl-3,5-dihydro-2H-1,4-benzoxazepine-4-sulfonamide (PubChem CID 166258875) has the molecular formula C15H21N3O4S
and a molecular weight of 339.42 g/mol. Its IUPAC name is N-(1-cyanopropan-2-yl)-9-methoxy-N-methyl-3,5-dihydro-2H-1,4-benzoxazepine-4-sulfonamide.
Molecular Properties
| Compound Name | N-(1-cyanopropan-2-yl)-9-methoxy-N-methyl-3,5-dihydro-2H-1,4-benzoxazepine-4-sulfonamide |
| PubChem CID | 166258875 |
| Molecular Formula | C15H21N3O4S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | N-(1-cyanopropan-2-yl)-9-methoxy-N-methyl-3,5-dihydro-2H-1,4-benzoxazepine-4-sulfonamide |
| SMILES | COc1cccc2c1OCCN(S(=O)(=O)N(C)C(C)CC#N)C2 |
| InChI | InChI=1S/C15H21N3O4S/c1-12(7-8-16)17(2)23(19,20)18-9-10-22-15-13(11-18)5-4-6-14(15)21-3/h4-6,12H,7,9-11H2,1-3H3 |
| InChIKey | XBQCCIOMZXPZML-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 82.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1-cyanopropan-2-yl)-9-methoxy-N-methyl-3,5-dihydro-2H-1,4-benzoxazepine-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-cyanopropan-2-yl)-9-methoxy-N-methyl-3,5-dihydro-2H-1,4-benzoxazepine-4-sulfonamide?
The IUPAC name of N-(1-cyanopropan-2-yl)-9-methoxy-N-methyl-3,5-dihydro-2H-1,4-benzoxazepine-4-sulfonamide (CID 166258875) is N-(1-cyanopropan-2-yl)-9-methoxy-N-methyl-3,5-dihydro-2H-1,4-benzoxazepine-4-sulfonamide.
What is the SMILES notation for N-(1-cyanopropan-2-yl)-9-methoxy-N-methyl-3,5-dihydro-2H-1,4-benzoxazepine-4-sulfonamide?
The canonical SMILES for N-(1-cyanopropan-2-yl)-9-methoxy-N-methyl-3,5-dihydro-2H-1,4-benzoxazepine-4-sulfonamide is COc1cccc2c1OCCN(S(=O)(=O)N(C)C(C)CC#N)C2.
What is the InChIKey of N-(1-cyanopropan-2-yl)-9-methoxy-N-methyl-3,5-dihydro-2H-1,4-benzoxazepine-4-sulfonamide?
The InChIKey is XBQCCIOMZXPZML-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O4S/c1-12(7-8-16)17(2)23(19,20)18-9-10-22-15-13(11-18)5-4-6-14(15)21-3/h4-6,12H,7,9-11H2,1-3H3.
What are the key properties of N-(1-cyanopropan-2-yl)-9-methoxy-N-methyl-3,5-dihydro-2H-1,4-benzoxazepine-4-sulfonamide?
N-(1-cyanopropan-2-yl)-9-methoxy-N-methyl-3,5-dihydro-2H-1,4-benzoxazepine-4-sulfonamide has a molecular weight of 339.42 g/mol, XLogP of 1.37, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-cyanopropan-2-yl)-9-methoxy-N-methyl-3,5-dihydro-2H-1,4-benzoxazepine-4-sulfonamide is sourced from PubChem (CID 166258875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).