About 9-[(5-cyclobutyl-1,3,4-oxadiazol-2-yl)methyl]-1-oxa-9-azaspiro[4.5]decane
9-[(5-cyclobutyl-1,3,4-oxadiazol-2-yl)methyl]-1-oxa-9-azaspiro[4.5]decane (PubChem CID 166260218) has the molecular formula C15H23N3O2
and a molecular weight of 277.37 g/mol. Its IUPAC name is 9-[(5-cyclobutyl-1,3,4-oxadiazol-2-yl)methyl]-1-oxa-9-azaspiro[4.5]decane.
Molecular Properties
| Compound Name | 9-[(5-cyclobutyl-1,3,4-oxadiazol-2-yl)methyl]-1-oxa-9-azaspiro[4.5]decane |
| PubChem CID | 166260218 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 9-[(5-cyclobutyl-1,3,4-oxadiazol-2-yl)methyl]-1-oxa-9-azaspiro[4.5]decane |
| SMILES | C1CC(c2nnc(CN3CCCC4(CCCO4)C3)o2)C1 |
| InChI | InChI=1S/C15H23N3O2/c1-4-12(5-1)14-17-16-13(20-14)10-18-8-2-6-15(11-18)7-3-9-19-15/h12H,1-11H2 |
| InChIKey | OLVXBHVKBSHNRH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 9-[(5-cyclobutyl-1,3,4-oxadiazol-2-yl)methyl]-1-oxa-9-azaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[(5-cyclobutyl-1,3,4-oxadiazol-2-yl)methyl]-1-oxa-9-azaspiro[4.5]decane?
The IUPAC name of 9-[(5-cyclobutyl-1,3,4-oxadiazol-2-yl)methyl]-1-oxa-9-azaspiro[4.5]decane (CID 166260218) is 9-[(5-cyclobutyl-1,3,4-oxadiazol-2-yl)methyl]-1-oxa-9-azaspiro[4.5]decane.
What is the SMILES notation for 9-[(5-cyclobutyl-1,3,4-oxadiazol-2-yl)methyl]-1-oxa-9-azaspiro[4.5]decane?
The canonical SMILES for 9-[(5-cyclobutyl-1,3,4-oxadiazol-2-yl)methyl]-1-oxa-9-azaspiro[4.5]decane is C1CC(c2nnc(CN3CCCC4(CCCO4)C3)o2)C1.
What is the InChIKey of 9-[(5-cyclobutyl-1,3,4-oxadiazol-2-yl)methyl]-1-oxa-9-azaspiro[4.5]decane?
The InChIKey is OLVXBHVKBSHNRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3O2/c1-4-12(5-1)14-17-16-13(20-14)10-18-8-2-6-15(11-18)7-3-9-19-15/h12H,1-11H2.
What are the key properties of 9-[(5-cyclobutyl-1,3,4-oxadiazol-2-yl)methyl]-1-oxa-9-azaspiro[4.5]decane?
9-[(5-cyclobutyl-1,3,4-oxadiazol-2-yl)methyl]-1-oxa-9-azaspiro[4.5]decane has a molecular weight of 277.37 g/mol, XLogP of 2.48, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[(5-cyclobutyl-1,3,4-oxadiazol-2-yl)methyl]-1-oxa-9-azaspiro[4.5]decane is sourced from PubChem (CID 166260218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).