C24H24F3N3O4 — CID 166261411
1,3-dimethyl-2-oxo-N-(1,2,3,4-tetrahydroisoquinolin-1-ylmethyl)quinoline-4-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 166261411) has the molecular formula C24H24F3N3O4 and a molecular weight of 475.47 g/mol. Its IUPAC name is 1,3-dimethyl-2-oxo-N-(1,2,3,4-tetrahydroisoquinolin-1-ylmethyl)quinoline-4-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 1,3-dimethyl-2-oxo-N-(1,2,3,4-tetrahydroisoquinolin-1-ylmethyl)quinoline-4-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166261411 |
| Molecular Formula | C24H24F3N3O4 |
| Molecular Weight | 475.47 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 1,3-dimethyl-2-oxo-N-(1,2,3,4-tetrahydroisoquinolin-1-ylmethyl)quinoline-4-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1c(C(=O)NCC2NCCc3ccccc32)c2ccccc2n(C)c1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H23N3O2.C2HF3O2/c1-14-20(17-9-5-6-10-19(17)25(2)22(14)27)21(26)24-13-18-16-8-4-3-7-15(16)11-12-23-18;3-2(4,5)1(6)7/h3-10,18,23H,11-13H2,1-2H3,(H,24,26);(H,6,7) |
| InChIKey | LXOKMHFBYLNKAO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.47 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |