About N-[2-(1,2-benzothiazol-3-yl)ethyl]-5-piperidin-4-yl-1,3-oxazole-4-carboxamide
N-[2-(1,2-benzothiazol-3-yl)ethyl]-5-piperidin-4-yl-1,3-oxazole-4-carboxamide (PubChem CID 166261564) has the molecular formula C18H20N4O2S
and a molecular weight of 356.45 g/mol. Its IUPAC name is N-[2-(1,2-benzothiazol-3-yl)ethyl]-5-piperidin-4-yl-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | N-[2-(1,2-benzothiazol-3-yl)ethyl]-5-piperidin-4-yl-1,3-oxazole-4-carboxamide |
| PubChem CID | 166261564 |
| Molecular Formula | C18H20N4O2S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | N-[2-(1,2-benzothiazol-3-yl)ethyl]-5-piperidin-4-yl-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NCCc1nsc2ccccc12)c1ncoc1C1CCNCC1 |
| InChI | InChI=1S/C18H20N4O2S/c23-18(16-17(24-11-21-16)12-5-8-19-9-6-12)20-10-7-14-13-3-1-2-4-15(13)25-22-14/h1-4,11-12,19H,5-10H2,(H,20,23) |
| InChIKey | UMWVGMRYSONBQO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[2-(1,2-benzothiazol-3-yl)ethyl]-5-piperidin-4-yl-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1,2-benzothiazol-3-yl)ethyl]-5-piperidin-4-yl-1,3-oxazole-4-carboxamide?
The IUPAC name of N-[2-(1,2-benzothiazol-3-yl)ethyl]-5-piperidin-4-yl-1,3-oxazole-4-carboxamide (CID 166261564) is N-[2-(1,2-benzothiazol-3-yl)ethyl]-5-piperidin-4-yl-1,3-oxazole-4-carboxamide.
What is the SMILES notation for N-[2-(1,2-benzothiazol-3-yl)ethyl]-5-piperidin-4-yl-1,3-oxazole-4-carboxamide?
The canonical SMILES for N-[2-(1,2-benzothiazol-3-yl)ethyl]-5-piperidin-4-yl-1,3-oxazole-4-carboxamide is O=C(NCCc1nsc2ccccc12)c1ncoc1C1CCNCC1.
What is the InChIKey of N-[2-(1,2-benzothiazol-3-yl)ethyl]-5-piperidin-4-yl-1,3-oxazole-4-carboxamide?
The InChIKey is UMWVGMRYSONBQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N4O2S/c23-18(16-17(24-11-21-16)12-5-8-19-9-6-12)20-10-7-14-13-3-1-2-4-15(13)25-22-14/h1-4,11-12,19H,5-10H2,(H,20,23).
What are the key properties of N-[2-(1,2-benzothiazol-3-yl)ethyl]-5-piperidin-4-yl-1,3-oxazole-4-carboxamide?
N-[2-(1,2-benzothiazol-3-yl)ethyl]-5-piperidin-4-yl-1,3-oxazole-4-carboxamide has a molecular weight of 356.45 g/mol, XLogP of 2.72, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1,2-benzothiazol-3-yl)ethyl]-5-piperidin-4-yl-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 166261564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).