About (1-aminocyclopropyl)-[3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]methanone
(1-aminocyclopropyl)-[3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]methanone (PubChem CID 166261784) has the molecular formula C11H13F3N4O
and a molecular weight of 274.25 g/mol. Its IUPAC name is (1-aminocyclopropyl)-[3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]methanone.
Molecular Properties
| Compound Name | (1-aminocyclopropyl)-[3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]methanone |
| PubChem CID | 166261784 |
| Molecular Formula | C11H13F3N4O |
| Molecular Weight | 274.25 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | (1-aminocyclopropyl)-[3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]methanone |
| SMILES | NC1(C(=O)N2CCn3c(cnc3C(F)(F)F)C2)CC1 |
| InChI | InChI=1S/C11H13F3N4O/c12-11(13,14)8-16-5-7-6-17(3-4-18(7)8)9(19)10(15)1-2-10/h5H,1-4,6,15H2 |
| InChIKey | YNABZMYVHCFOMA-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.25 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-aminocyclopropyl)-[3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-aminocyclopropyl)-[3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]methanone?
The IUPAC name of (1-aminocyclopropyl)-[3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]methanone (CID 166261784) is (1-aminocyclopropyl)-[3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]methanone.
What is the SMILES notation for (1-aminocyclopropyl)-[3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]methanone?
The canonical SMILES for (1-aminocyclopropyl)-[3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]methanone is NC1(C(=O)N2CCn3c(cnc3C(F)(F)F)C2)CC1.
What is the InChIKey of (1-aminocyclopropyl)-[3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]methanone?
The InChIKey is YNABZMYVHCFOMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F3N4O/c12-11(13,14)8-16-5-7-6-17(3-4-18(7)8)9(19)10(15)1-2-10/h5H,1-4,6,15H2.
What are the key properties of (1-aminocyclopropyl)-[3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]methanone?
(1-aminocyclopropyl)-[3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]methanone has a molecular weight of 274.25 g/mol, XLogP of 0.74, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-aminocyclopropyl)-[3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]methanone is sourced from PubChem (CID 166261784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).