C16H23NO5 — CID 166262326
(1R,2S,3R,4S)-3-[[(1R,3aS,7aS)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyran-1-carbonyl]amino]bicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 166262326) has the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. Its IUPAC name is (1R,2S,3R,4S)-3-[[(1R,3aS,7aS)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyran-1-carbonyl]amino]bicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | (1R,2S,3R,4S)-3-[[(1R,3aS,7aS)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyran-1-carbonyl]amino]bicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 166262326 |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | (1R,2S,3R,4S)-3-[[(1R,3aS,7aS)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyran-1-carbonyl]amino]bicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1[C@@H]2CC[C@@H](C2)[C@H]1NC(=O)[C@@H]1OC[C@@H]2COCC[C@@H]21 |
| InChI | InChI=1S/C16H23NO5/c18-15(14-11-3-4-21-6-10(11)7-22-14)17-13-9-2-1-8(5-9)12(13)16(19)20/h8-14H,1-7H2,(H,17,18)(H,19,20)/t8-,9+,10+,11+,12+,13-,14-/m1/s1 |
| InChIKey | GOLJHKNQRLNKKZ-LZRJYULZSA-N |
| XLogP | 0.65 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |