C14H21N3O3S2 — CID 166262360
(3aS,6aR)-3a-methyl-2,2-dioxo-N-(4-propan-2-yl-1,3-thiazol-2-yl)-3,4,6,6a-tetrahydro-1H-thieno[3,4-c]pyrrole-5-carboxamide (PubChem CID 166262360) has the molecular formula C14H21N3O3S2 and a molecular weight of 343.47 g/mol. Its IUPAC name is (3aS,6aR)-3a-methyl-2,2-dioxo-N-(4-propan-2-yl-1,3-thiazol-2-yl)-3,4,6,6a-tetrahydro-1H-thieno[3,4-c]pyrrole-5-carboxamide.
| Compound Name | (3aS,6aR)-3a-methyl-2,2-dioxo-N-(4-propan-2-yl-1,3-thiazol-2-yl)-3,4,6,6a-tetrahydro-1H-thieno[3,4-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 166262360 |
| Molecular Formula | C14H21N3O3S2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | (3aS,6aR)-3a-methyl-2,2-dioxo-N-(4-propan-2-yl-1,3-thiazol-2-yl)-3,4,6,6a-tetrahydro-1H-thieno[3,4-c]pyrrole-5-carboxamide |
| SMILES | CC(C)c1csc(NC(=O)N2C[C@@H]3CS(=O)(=O)C[C@]3(C)C2)n1 |
| InChI | InChI=1S/C14H21N3O3S2/c1-9(2)11-5-21-12(15-11)16-13(18)17-4-10-6-22(19,20)8-14(10,3)7-17/h5,9-10H,4,6-8H2,1-3H3,(H,15,16,18)/t10-,14+/m1/s1 |
| InChIKey | HCHSMEKDPUALLZ-YGRLFVJLSA-N |
| XLogP | 2.16 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |