C11H20N6O2 — CID 166263013
4-(hydroxymethyl)-N-[3-(tetrazol-1-yl)propyl]piperidine-1-carboxamide (PubChem CID 166263013) has the molecular formula C11H20N6O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is 4-(hydroxymethyl)-N-[3-(tetrazol-1-yl)propyl]piperidine-1-carboxamide.
| Compound Name | 4-(hydroxymethyl)-N-[3-(tetrazol-1-yl)propyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 166263013 |
| Molecular Formula | C11H20N6O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 4-(hydroxymethyl)-N-[3-(tetrazol-1-yl)propyl]piperidine-1-carboxamide |
| SMILES | O=C(NCCCn1cnnn1)N1CCC(CO)CC1 |
| InChI | InChI=1S/C11H20N6O2/c18-8-10-2-6-16(7-3-10)11(19)12-4-1-5-17-9-13-14-15-17/h9-10,18H,1-8H2,(H,12,19) |
| InChIKey | YXGNHWSIRQRNCM-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|