About 2-[[1-(2,4-dimethylthiophen-3-yl)sulfonylpiperidin-4-yl]methoxy]acetic acid
2-[[1-(2,4-dimethylthiophen-3-yl)sulfonylpiperidin-4-yl]methoxy]acetic acid (PubChem CID 166263436) has the molecular formula C14H21NO5S2
and a molecular weight of 347.46 g/mol. Its IUPAC name is 2-[[1-(2,4-dimethylthiophen-3-yl)sulfonylpiperidin-4-yl]methoxy]acetic acid.
Molecular Properties
| Compound Name | 2-[[1-(2,4-dimethylthiophen-3-yl)sulfonylpiperidin-4-yl]methoxy]acetic acid |
| PubChem CID | 166263436 |
| Molecular Formula | C14H21NO5S2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 2-[[1-(2,4-dimethylthiophen-3-yl)sulfonylpiperidin-4-yl]methoxy]acetic acid |
| SMILES | Cc1csc(C)c1S(=O)(=O)N1CCC(COCC(=O)O)CC1 |
| InChI | InChI=1S/C14H21NO5S2/c1-10-9-21-11(2)14(10)22(18,19)15-5-3-12(4-6-15)7-20-8-13(16)17/h9,12H,3-8H2,1-2H3,(H,16,17) |
| InChIKey | GWIAUXBLRVBZQP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[1-(2,4-dimethylthiophen-3-yl)sulfonylpiperidin-4-yl]methoxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[1-(2,4-dimethylthiophen-3-yl)sulfonylpiperidin-4-yl]methoxy]acetic acid?
The IUPAC name of 2-[[1-(2,4-dimethylthiophen-3-yl)sulfonylpiperidin-4-yl]methoxy]acetic acid (CID 166263436) is 2-[[1-(2,4-dimethylthiophen-3-yl)sulfonylpiperidin-4-yl]methoxy]acetic acid.
What is the SMILES notation for 2-[[1-(2,4-dimethylthiophen-3-yl)sulfonylpiperidin-4-yl]methoxy]acetic acid?
The canonical SMILES for 2-[[1-(2,4-dimethylthiophen-3-yl)sulfonylpiperidin-4-yl]methoxy]acetic acid is Cc1csc(C)c1S(=O)(=O)N1CCC(COCC(=O)O)CC1.
What is the InChIKey of 2-[[1-(2,4-dimethylthiophen-3-yl)sulfonylpiperidin-4-yl]methoxy]acetic acid?
The InChIKey is GWIAUXBLRVBZQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO5S2/c1-10-9-21-11(2)14(10)22(18,19)15-5-3-12(4-6-15)7-20-8-13(16)17/h9,12H,3-8H2,1-2H3,(H,16,17).
What are the key properties of 2-[[1-(2,4-dimethylthiophen-3-yl)sulfonylpiperidin-4-yl]methoxy]acetic acid?
2-[[1-(2,4-dimethylthiophen-3-yl)sulfonylpiperidin-4-yl]methoxy]acetic acid has a molecular weight of 347.46 g/mol, XLogP of 1.87, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[1-(2,4-dimethylthiophen-3-yl)sulfonylpiperidin-4-yl]methoxy]acetic acid is sourced from PubChem (CID 166263436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).