C15H26N6O — CID 166263847
N-(2,3,4,5,6,7,8,8a-octahydro-1H-cyclohepta[b]pyrrol-3a-yl)-2-tert-butyltetrazole-5-carboxamide (PubChem CID 166263847) has the molecular formula C15H26N6O and a molecular weight of 306.41 g/mol. Its IUPAC name is N-(2,3,4,5,6,7,8,8a-octahydro-1H-cyclohepta[b]pyrrol-3a-yl)-2-tert-butyltetrazole-5-carboxamide.
| Compound Name | N-(2,3,4,5,6,7,8,8a-octahydro-1H-cyclohepta[b]pyrrol-3a-yl)-2-tert-butyltetrazole-5-carboxamide |
|---|---|
| PubChem CID | 166263847 |
| Molecular Formula | C15H26N6O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | N-(2,3,4,5,6,7,8,8a-octahydro-1H-cyclohepta[b]pyrrol-3a-yl)-2-tert-butyltetrazole-5-carboxamide |
| SMILES | CC(C)(C)n1nnc(C(=O)NC23CCCCCC2NCC3)n1 |
| InChI | InChI=1S/C15H26N6O/c1-14(2,3)21-19-12(18-20-21)13(22)17-15-8-6-4-5-7-11(15)16-10-9-15/h11,16H,4-10H2,1-3H3,(H,17,22) |
| InChIKey | CYDBVUQFXUAELL-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |